C20H24BrN7O2 — CID 138574684
2-(3-bromophenyl)-N-[6-[4-[4-[hydroxy(methylamino)methyl]triazol-1-yl]butyl]pyridazin-3-yl]acetamide (PubChem CID 138574684) has the molecular formula C20H24BrN7O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[6-[4-[4-[hydroxy(methylamino)methyl]triazol-1-yl]butyl]pyridazin-3-yl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[6-[4-[4-[hydroxy(methylamino)methyl]triazol-1-yl]butyl]pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 138574684 |
| Molecular Formula | C20H24BrN7O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-(3-bromophenyl)-N-[6-[4-[4-[hydroxy(methylamino)methyl]triazol-1-yl]butyl]pyridazin-3-yl]acetamide |
| SMILES | CNC(O)c1cn(CCCCc2ccc(NC(=O)Cc3cccc(Br)c3)nn2)nn1 |
| InChI | InChI=1S/C20H24BrN7O2/c1-22-20(30)17-13-28(27-25-17)10-3-2-7-16-8-9-18(26-24-16)23-19(29)12-14-5-4-6-15(21)11-14/h4-6,8-9,11,13,20,22,30H,2-3,7,10,12H2,1H3,(H,23,26,29) |
| InChIKey | YYQJXAQNSZDCIX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|