C15H20N6O — CID 146527093
N-[6-[4-(4-methyltriazol-1-yl)butyl]pyridazin-3-yl]cyclopropanecarboxamide (PubChem CID 146527093) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[6-[4-(4-methyltriazol-1-yl)butyl]pyridazin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-[4-(4-methyltriazol-1-yl)butyl]pyridazin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 146527093 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[6-[4-(4-methyltriazol-1-yl)butyl]pyridazin-3-yl]cyclopropanecarboxamide |
| SMILES | Cc1cn(CCCCc2ccc(NC(=O)C3CC3)nn2)nn1 |
| InChI | InChI=1S/C15H20N6O/c1-11-10-21(20-17-11)9-3-2-4-13-7-8-14(19-18-13)16-15(22)12-5-6-12/h7-8,10,12H,2-6,9H2,1H3,(H,16,19,22) |
| InChIKey | DKCRWMNLGKRTHM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|