C18H26N8O2 — CID 146526975
1-[4-[6-[[(Z)-3-aminohex-3-enoyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide (PubChem CID 146526975) has the molecular formula C18H26N8O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[4-[6-[[(Z)-3-aminohex-3-enoyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-[4-[6-[[(Z)-3-aminohex-3-enoyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 146526975 |
| Molecular Formula | C18H26N8O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[4-[6-[[(Z)-3-aminohex-3-enoyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
| SMILES | CC/C=C(\N)CC(=O)Nc1ccc(CCCCn2cc(C(=O)NC)nn2)nn1 |
| InChI | InChI=1S/C18H26N8O2/c1-3-6-13(19)11-17(27)21-16-9-8-14(22-24-16)7-4-5-10-26-12-15(23-25-26)18(28)20-2/h6,8-9,12H,3-5,7,10-11,19H2,1-2H3,(H,20,28)(H,21,24,27)/b13-6- |
| InChIKey | GEECWTKTZQBVCI-MLPAPPSSSA-N |
| XLogP | 1.03 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|