About 2-aminobenzenesulfonamide;4-methoxypyrimidine
2-aminobenzenesulfonamide;4-methoxypyrimidine (PubChem CID 163526162) has the molecular formula C11H14N4O3S
and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-aminobenzenesulfonamide;4-methoxypyrimidine.
Molecular Properties
| Compound Name | 2-aminobenzenesulfonamide;4-methoxypyrimidine |
| PubChem CID | 163526162 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-aminobenzenesulfonamide;4-methoxypyrimidine |
| SMILES | COc1ccncn1.Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C6H8N2O2S.C5H6N2O/c7-5-3-1-2-4-6(5)11(8,9)10;1-8-5-2-3-6-4-7-5/h1-4H,7H2,(H2,8,9,10);2-4H,1H3 |
| InChIKey | DOYGUAXKGYBUIS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenesulfonamide;4-methoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenesulfonamide;4-methoxypyrimidine?
The IUPAC name of 2-aminobenzenesulfonamide;4-methoxypyrimidine (CID 163526162) is 2-aminobenzenesulfonamide;4-methoxypyrimidine.
What is the SMILES notation for 2-aminobenzenesulfonamide;4-methoxypyrimidine?
The canonical SMILES for 2-aminobenzenesulfonamide;4-methoxypyrimidine is COc1ccncn1.Nc1ccccc1S(N)(=O)=O.
What is the InChIKey of 2-aminobenzenesulfonamide;4-methoxypyrimidine?
The InChIKey is DOYGUAXKGYBUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.C5H6N2O/c7-5-3-1-2-4-6(5)11(8,9)10;1-8-5-2-3-6-4-7-5/h1-4H,7H2,(H2,8,9,10);2-4H,1H3.
What are the key properties of 2-aminobenzenesulfonamide;4-methoxypyrimidine?
2-aminobenzenesulfonamide;4-methoxypyrimidine has a molecular weight of 282.33 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenesulfonamide;4-methoxypyrimidine is sourced from PubChem (CID 163526162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).