C25H35FN4O2 — CID 163526319
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-(2-fluoro-4-methylphenyl)-5-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-c]azocine-3-carboxamide (PubChem CID 163526319) has the molecular formula C25H35FN4O2 and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-(2-fluoro-4-methylphenyl)-5-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-c]azocine-3-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-(2-fluoro-4-methylphenyl)-5-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-c]azocine-3-carboxamide |
|---|---|
| PubChem CID | 163526319 |
| Molecular Formula | C25H35FN4O2 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-(2-fluoro-4-methylphenyl)-5-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-c]azocine-3-carboxamide |
| SMILES | CNC(=O)[C@@H](NC(=O)C1=C2CN(C)CCCCC2C(c2ccc(C)cc2F)=N1)C(C)(C)C |
| InChI | InChI=1S/C25H35FN4O2/c1-15-10-11-17(19(26)13-15)20-16-9-7-8-12-30(6)14-18(16)21(28-20)23(31)29-22(24(32)27-5)25(2,3)4/h10-11,13,16,22H,7-9,12,14H2,1-6H3,(H,27,32)(H,29,31)/t16?,22-/m1/s1 |
| InChIKey | DPBNTUJPRHMZRU-VXNXSFHZSA-N |
| XLogP | 3.20 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |