C17H28N2O — CID 163528071
2-N,3-N-dicyclohexyl-4,4-dimethyloxetane-2,3-diimine (PubChem CID 163528071) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-N,3-N-dicyclohexyl-4,4-dimethyloxetane-2,3-diimine.
| Compound Name | 2-N,3-N-dicyclohexyl-4,4-dimethyloxetane-2,3-diimine |
|---|---|
| PubChem CID | 163528071 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-N,3-N-dicyclohexyl-4,4-dimethyloxetane-2,3-diimine |
| SMILES | CC1(C)OC(=N\C2CCCCC2)/C1=N/C1CCCCC1 |
| InChI | InChI=1S/C17H28N2O/c1-17(2)15(18-13-9-5-3-6-10-13)16(20-17)19-14-11-7-4-8-12-14/h13-14H,3-12H2,1-2H3/b18-15-,19-16- |
| InChIKey | DQNMCQPJXHKNDO-SAQCZPFTSA-N |
| XLogP | 4.30 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|