C26H23N3O9 — CID 11706302
dimethyl 5'-cyclohexylimino-2,7-dinitrospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate (PubChem CID 11706302) has the molecular formula C26H23N3O9 and a molecular weight of 521.48 g/mol. Its IUPAC name is dimethyl 5'-cyclohexylimino-2,7-dinitrospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate.
| Compound Name | dimethyl 5'-cyclohexylimino-2,7-dinitrospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11706302 |
| Molecular Formula | C26H23N3O9 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | dimethyl 5'-cyclohexylimino-2,7-dinitrospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(O/C1=N\C1CCCCC1)c1cc([N+](=O)[O-])ccc1-c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C26H23N3O9/c1-36-24(30)21-22(25(31)37-2)26(38-23(21)27-14-6-4-3-5-7-14)19-12-15(28(32)33)8-10-17(19)18-11-9-16(29(34)35)13-20(18)26/h8-14H,3-7H2,1-2H3/b27-23- |
| InChIKey | NKLTVPJEFFJBMJ-VYIQYICTSA-N |
| XLogP | 4.13 |
| TPSA | 160.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|