C15H12BrNO8 — CID 53309816
dimethyl 2-(bromomethyl)-2-(4-nitrophenyl)-5-oxofuran-3,4-dicarboxylate (PubChem CID 53309816) has the molecular formula C15H12BrNO8 and a molecular weight of 414.16 g/mol. Its IUPAC name is dimethyl 2-(bromomethyl)-2-(4-nitrophenyl)-5-oxofuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(bromomethyl)-2-(4-nitrophenyl)-5-oxofuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 53309816 |
| Molecular Formula | C15H12BrNO8 |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | dimethyl 2-(bromomethyl)-2-(4-nitrophenyl)-5-oxofuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(CBr)(c2ccc([N+](=O)[O-])cc2)OC1=O |
| InChI | InChI=1S/C15H12BrNO8/c1-23-12(18)10-11(14(20)24-2)15(7-16,25-13(10)19)8-3-5-9(6-4-8)17(21)22/h3-6H,7H2,1-2H3 |
| InChIKey | QJTJFQYBNGUVQN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|