C29H23ClF3N3O2 — CID 163530208
N-[3-(7-chloro-2-oxo-1-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 163530208) has the molecular formula C29H23ClF3N3O2 and a molecular weight of 537.97 g/mol. Its IUPAC name is N-[3-(7-chloro-2-oxo-1-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(7-chloro-2-oxo-1-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163530208 |
| Molecular Formula | C29H23ClF3N3O2 |
| Molecular Weight | 537.97 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-[3-(7-chloro-2-oxo-1-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-c1cc2c(n(-c3ccccc3)c1=O)CC(Cl)NC2 |
| InChI | InChI=1S/C29H23ClF3N3O2/c1-17-10-11-21(35-27(37)18-6-5-7-20(12-18)29(31,32)33)14-23(17)24-13-19-16-34-26(30)15-25(19)36(28(24)38)22-8-3-2-4-9-22/h2-14,26,34H,15-16H2,1H3,(H,35,37) |
| InChIKey | DSILEYKCPQUVPX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.97 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|