About 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide
3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide (PubChem CID 163531394) has the molecular formula C7H11N2-
and a molecular weight of 123.18 g/mol. Its IUPAC name is 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide.
Analyze 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide?
The IUPAC name of 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide (CID 163531394) is 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide.
What is the SMILES notation for 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide?
The canonical SMILES for 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide is CC1=C[N-]N2CCCC12.
What is the InChIKey of 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide?
The InChIKey is BNFBOPOVUKBKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2/c1-6-5-8-9-4-2-3-7(6)9/h5,7H,2-4H2,1H3/q-1.
What are the key properties of 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide?
3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide has a molecular weight of 123.18 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-1-ide is sourced from PubChem (CID 163531394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).