C37H41FN4O6 — CID 163532996
(2S,4R)-4-[[2-(2-fluorophenyl)-6-methoxy-[1]benzofuro[3,2-b]pyridin-4-yl]oxy]-1-[(Z)-9-[(1S)-2-(methylcarbamoyl)cyclopropyl]non-8-enoyl]pyrrolidine-2-carboxamide (PubChem CID 163532996) has the molecular formula C37H41FN4O6 and a molecular weight of 656.76 g/mol. Its IUPAC name is (2S,4R)-4-[[2-(2-fluorophenyl)-6-methoxy-[1]benzofuro[3,2-b]pyridin-4-yl]oxy]-1-[(Z)-9-[(1S)-2-(methylcarbamoyl)cyclopropyl]non-8-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[[2-(2-fluorophenyl)-6-methoxy-[1]benzofuro[3,2-b]pyridin-4-yl]oxy]-1-[(Z)-9-[(1S)-2-(methylcarbamoyl)cyclopropyl]non-8-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163532996 |
| Molecular Formula | C37H41FN4O6 |
| Molecular Weight | 656.76 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | (2S,4R)-4-[[2-(2-fluorophenyl)-6-methoxy-[1]benzofuro[3,2-b]pyridin-4-yl]oxy]-1-[(Z)-9-[(1S)-2-(methylcarbamoyl)cyclopropyl]non-8-enoyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1C[C@H]1/C=C\CCCCCCC(=O)N1C[C@H](Oc2cc(-c3ccccc3F)nc3c2oc2c(OC)cccc23)C[C@H]1C(N)=O |
| InChI | InChI=1S/C37H41FN4O6/c1-40-37(45)26-18-22(26)12-7-5-3-4-6-8-17-32(43)42-21-23(19-29(42)36(39)44)47-31-20-28(24-13-9-10-15-27(24)38)41-33-25-14-11-16-30(46-2)34(25)48-35(31)33/h7,9-16,20,22-23,26,29H,3-6,8,17-19,21H2,1-2H3,(H2,39,44)(H,40,45)/b12-7-/t22-,23-,26?,29+/m1/s1 |
| InChIKey | DUOQCOIODGFXEA-GAOFWYJOSA-N |
| XLogP | 5.91 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|