C18H31NO — CID 163533352
1-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl)cyclohexen-1-yl]ethanol (PubChem CID 163533352) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl)cyclohexen-1-yl]ethanol.
| Compound Name | 1-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl)cyclohexen-1-yl]ethanol |
|---|---|
| PubChem CID | 163533352 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl)cyclohexen-1-yl]ethanol |
| SMILES | CC(O)C1=CCC(C2CC3CCCC(C)C3CN2)CC1 |
| InChI | InChI=1S/C18H31NO/c1-12-4-3-5-16-10-18(19-11-17(12)16)15-8-6-14(7-9-15)13(2)20/h6,12-13,15-20H,3-5,7-11H2,1-2H3 |
| InChIKey | DUVRRINUPADPTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|