C14H16F3N2O5P — CID 163533426
2-cinnolin-2-ium-2-ylethyl(ethoxy)phosphinic acid;2,2,2-trifluoroacetate (PubChem CID 163533426) has the molecular formula C14H16F3N2O5P and a molecular weight of 380.26 g/mol. Its IUPAC name is 2-cinnolin-2-ium-2-ylethyl(ethoxy)phosphinic acid;2,2,2-trifluoroacetate.
| Compound Name | 2-cinnolin-2-ium-2-ylethyl(ethoxy)phosphinic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 163533426 |
| Molecular Formula | C14H16F3N2O5P |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-cinnolin-2-ium-2-ylethyl(ethoxy)phosphinic acid;2,2,2-trifluoroacetate |
| SMILES | CCOP(=O)(O)CC[n+]1ccc2ccccc2n1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H15N2O3P.C2HF3O2/c1-2-17-18(15,16)10-9-14-8-7-11-5-3-4-6-12(11)13-14;3-2(4,5)1(6)7/h3-8H,2,9-10H2,1H3;(H,6,7) |
| InChIKey | OOPUCBKTUYIEFU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|