C18H16F3N4O4+ — CID 154673329
3-(4-cinnolin-3-ylpyridazin-1-ium-1-yl)propanoic acid;methyl 2,2,2-trifluoroacetate (PubChem CID 154673329) has the molecular formula C18H16F3N4O4+ and a molecular weight of 409.34 g/mol. Its IUPAC name is 3-(4-cinnolin-3-ylpyridazin-1-ium-1-yl)propanoic acid;methyl 2,2,2-trifluoroacetate.
| Compound Name | 3-(4-cinnolin-3-ylpyridazin-1-ium-1-yl)propanoic acid;methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154673329 |
| Molecular Formula | C18H16F3N4O4+ |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 3-(4-cinnolin-3-ylpyridazin-1-ium-1-yl)propanoic acid;methyl 2,2,2-trifluoroacetate |
| SMILES | COC(=O)C(F)(F)F.O=C(O)CC[n+]1ccc(-c2cc3ccccc3nn2)cn1 |
| InChI | InChI=1S/C15H12N4O2.C3H3F3O2/c20-15(21)6-8-19-7-5-12(10-16-19)14-9-11-3-1-2-4-13(11)17-18-14;1-8-2(7)3(4,5)6/h1-5,7,9-10H,6,8H2;1H3/p+1 |
| InChIKey | UECWRXIAKVWTNN-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|