C24H27ClF2N3O3S+ — CID 163534123
2-[[3-(3-chloro-4-fluorophenyl)-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-4-oxopyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium (PubChem CID 163534123) has the molecular formula C24H27ClF2N3O3S+ and a molecular weight of 511.01 g/mol. Its IUPAC name is 2-[[3-(3-chloro-4-fluorophenyl)-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-4-oxopyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[[3-(3-chloro-4-fluorophenyl)-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-4-oxopyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 163534123 |
| Molecular Formula | C24H27ClF2N3O3S+ |
| Molecular Weight | 511.01 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[[3-(3-chloro-4-fluorophenyl)-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-4-oxopyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsulfanium |
| SMILES | C[S+](C)CCOCn1cc(-c2ccc(F)c(Cl)c2)c2c(=O)n(CC(=O)N3CCC(F)C3)ccc21 |
| InChI | InChI=1S/C24H27ClF2N3O3S/c1-34(2)10-9-33-15-30-13-18(16-3-4-20(27)19(25)11-16)23-21(30)6-8-29(24(23)32)14-22(31)28-7-5-17(26)12-28/h3-4,6,8,11,13,17H,5,7,9-10,12,14-15H2,1-2H3/q+1 |
| InChIKey | DVMVUAPIDLBEDW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.01 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|