About 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane
3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane (PubChem CID 145329666) has the molecular formula C15H19BrFN3O2
and a molecular weight of 372.24 g/mol. Its IUPAC name is 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane.
Molecular Properties
| Compound Name | 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane |
| PubChem CID | 145329666 |
| Molecular Formula | C15H19BrFN3O2 |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane |
| SMILES | CC.O=C(Cn1ccc2[nH]cc(Br)c2c1=O)N1CCC(F)C1 |
| InChI | InChI=1S/C13H13BrFN3O2.C2H6/c14-9-5-16-10-2-4-18(13(20)12(9)10)7-11(19)17-3-1-8(15)6-17;1-2/h2,4-5,8,16H,1,3,6-7H2;1-2H3 |
| InChIKey | XTKQFJKJZWVEBG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane?
The IUPAC name of 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane (CID 145329666) is 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane.
What is the SMILES notation for 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane?
The canonical SMILES for 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane is CC.O=C(Cn1ccc2[nH]cc(Br)c2c1=O)N1CCC(F)C1.
What is the InChIKey of 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane?
The InChIKey is XTKQFJKJZWVEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrFN3O2.C2H6/c14-9-5-16-10-2-4-18(13(20)12(9)10)7-11(19)17-3-1-8(15)6-17;1-2/h2,4-5,8,16H,1,3,6-7H2;1-2H3.
What are the key properties of 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane?
3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane has a molecular weight of 372.24 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-[2-(3-fluoropyrrolidin-1-yl)-2-oxoethyl]-1H-pyrrolo[3,2-c]pyridin-4-one;ethane is sourced from PubChem (CID 145329666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).