C20H15BrF8N2 — CID 163534256
2-[3-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1-difluoroprop-2-enyl)pyrrolidin-1-yl]-6-bromopyridine (PubChem CID 163534256) has the molecular formula C20H15BrF8N2 and a molecular weight of 515.24 g/mol. Its IUPAC name is 2-[3-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1-difluoroprop-2-enyl)pyrrolidin-1-yl]-6-bromopyridine.
| Compound Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1-difluoroprop-2-enyl)pyrrolidin-1-yl]-6-bromopyridine |
|---|---|
| PubChem CID | 163534256 |
| Molecular Formula | C20H15BrF8N2 |
| Molecular Weight | 515.24 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1-difluoroprop-2-enyl)pyrrolidin-1-yl]-6-bromopyridine |
| SMILES | C=CC(F)(F)C1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCN(c2cccc(Br)n2)C1 |
| InChI | InChI=1S/C20H15BrF8N2/c1-2-18(22,23)17(6-7-31(11-17)16-5-3-4-15(21)30-16)12-8-13(19(24,25)26)10-14(9-12)20(27,28)29/h2-5,8-10H,1,6-7,11H2 |
| InChIKey | DVPNHLZTEFVZPO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.24 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|