About 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate
1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate (PubChem CID 163537674) has the molecular formula C13H34O2P2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate.
Molecular Properties
| Compound Name | 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate |
| PubChem CID | 163537674 |
| Molecular Formula | C13H34O2P2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate |
| SMILES | CCCCCP(=O)(C(C)CC)C(C)CC.O.P |
| InChI | InChI=1S/C13H29OP.H2O.H3P/c1-6-9-10-11-15(14,12(4)7-2)13(5)8-3;;/h12-13H,6-11H2,1-5H3;1H2;1H3 |
| InChIKey | RUXBONLQBRRQIC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate?
The IUPAC name of 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate (CID 163537674) is 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate.
What is the SMILES notation for 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate?
The canonical SMILES for 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate is CCCCCP(=O)(C(C)CC)C(C)CC.O.P.
What is the InChIKey of 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate?
The InChIKey is RUXBONLQBRRQIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29OP.H2O.H3P/c1-6-9-10-11-15(14,12(4)7-2)13(5)8-3;;/h12-13H,6-11H2,1-5H3;1H2;1H3.
What are the key properties of 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate?
1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate has a molecular weight of 284.36 g/mol, XLogP of 4.37, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-di(butan-2-yl)phosphorylpentane;phosphane;hydrate is sourced from PubChem (CID 163537674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).