About 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde
5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 163538471) has the molecular formula C23H20NO3-
and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 163538471 |
| Molecular Formula | C23H20NO3- |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | CC(ON([O-])C1=CC(C=O)=CCC1)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H20NO3/c1-16(27-24(26)20-10-6-7-17(13-20)15-25)23-21-11-4-2-8-18(21)14-19-9-3-5-12-22(19)23/h2-5,7-9,11-16H,6,10H2,1H3/q-1 |
| InChIKey | KVAXAQGEZCPXIO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde (CID 163538471) is 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde is CC(ON([O-])C1=CC(C=O)=CCC1)c1c2ccccc2cc2ccccc12.
What is the InChIKey of 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is KVAXAQGEZCPXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20NO3/c1-16(27-24(26)20-10-6-7-17(13-20)15-25)23-21-11-4-2-8-18(21)14-19-9-3-5-12-22(19)23/h2-5,7-9,11-16H,6,10H2,1H3/q-1.
What are the key properties of 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde?
5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 358.42 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-anthracen-9-ylethoxy(oxido)amino]cyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 163538471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).