About N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide
N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide (PubChem CID 163538470) has the molecular formula C23H21NO3
and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide.
Molecular Properties
| Compound Name | N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide |
| PubChem CID | 163538470 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide |
| SMILES | CC(O[NH+]([O-])C1=CC(C=O)=CCC1)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H21NO3/c1-16(27-24(26)20-10-6-7-17(13-20)15-25)23-21-11-4-2-8-18(21)14-19-9-3-5-12-22(19)23/h2-5,7-9,11-16,24H,6,10H2,1H3 |
| InChIKey | DZAJQTYHTGTZDM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide?
The IUPAC name of N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide (CID 163538470) is N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide.
What is the SMILES notation for N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide?
The canonical SMILES for N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide is CC(O[NH+]([O-])C1=CC(C=O)=CCC1)c1c2ccccc2cc2ccccc12.
What is the InChIKey of N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide?
The InChIKey is DZAJQTYHTGTZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-16(27-24(26)20-10-6-7-17(13-20)15-25)23-21-11-4-2-8-18(21)14-19-9-3-5-12-22(19)23/h2-5,7-9,11-16,24H,6,10H2,1H3.
What are the key properties of N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide?
N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide has a molecular weight of 359.43 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-anthracen-9-ylethoxy)-3-formylcyclohexa-1,3-dien-1-amine oxide is sourced from PubChem (CID 163538470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).