C20H17NO3 — CID 91527948
ethyl 5-anthracen-9-yl-2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 91527948) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 5-anthracen-9-yl-2,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-anthracen-9-yl-2,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 91527948 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | ethyl 5-anthracen-9-yl-2,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(c2c3ccccc3cc3ccccc23)ON1 |
| InChI | InChI=1S/C20H17NO3/c1-2-23-20(22)17-12-18(24-21-17)19-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)19/h3-12,18,21H,2H2,1H3 |
| InChIKey | UBLFNJPBRBHIKW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|