C18H16FNO3 — CID 57259651
ethyl 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylate (PubChem CID 57259651) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is ethyl 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 57259651 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(c2ccccc2)(c2ccc(F)cc2)ON1 |
| InChI | InChI=1S/C18H16FNO3/c1-2-22-17(21)16-12-18(23-20-16,13-6-4-3-5-7-13)14-8-10-15(19)11-9-14/h3-12,20H,2H2,1H3 |
| InChIKey | MRVQUMZQIAVGBS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |