C21H29IN5O- — CID 163538506
CID 163538506 (PubChem CID 163538506) has the molecular formula C21H29IN5O- and a molecular weight of 494.40 g/mol.
| Compound Name | CID 163538506 |
|---|---|
| PubChem CID | 163538506 |
| Molecular Formula | C21H29IN5O- |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | — |
| SMILES | [H]/N=c1/c(C(C)C)cnc(C(NC(=O)CN2CC[I-]CC2)c2ccccc2)n1C |
| InChI | InChI=1S/C21H29IN5O/c1-15(2)17-13-24-21(26(3)20(17)23)19(16-7-5-4-6-8-16)25-18(28)14-27-11-9-22-10-12-27/h4-8,13,15,19,23H,9-12,14H2,1-3H3,(H,25,28)/q-1/b23-20- |
| InChIKey | IBZLZIGDDWELHK-ATJXCDBQSA-N |
| XLogP | -1.37 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|