About (3-methyloxan-3-yl) 3-methylpentanoate
(3-methyloxan-3-yl) 3-methylpentanoate (PubChem CID 163541839) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (3-methyloxan-3-yl) 3-methylpentanoate.
Molecular Properties
| Compound Name | (3-methyloxan-3-yl) 3-methylpentanoate |
| PubChem CID | 163541839 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (3-methyloxan-3-yl) 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OC1(C)CCCOC1 |
| InChI | InChI=1S/C12H22O3/c1-4-10(2)8-11(13)15-12(3)6-5-7-14-9-12/h10H,4-9H2,1-3H3 |
| InChIKey | FBTQURJTKAJLEU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyloxan-3-yl) 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxan-3-yl) 3-methylpentanoate?
The IUPAC name of (3-methyloxan-3-yl) 3-methylpentanoate (CID 163541839) is (3-methyloxan-3-yl) 3-methylpentanoate.
What is the SMILES notation for (3-methyloxan-3-yl) 3-methylpentanoate?
The canonical SMILES for (3-methyloxan-3-yl) 3-methylpentanoate is CCC(C)CC(=O)OC1(C)CCCOC1.
What is the InChIKey of (3-methyloxan-3-yl) 3-methylpentanoate?
The InChIKey is FBTQURJTKAJLEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-4-10(2)8-11(13)15-12(3)6-5-7-14-9-12/h10H,4-9H2,1-3H3.
What are the key properties of (3-methyloxan-3-yl) 3-methylpentanoate?
(3-methyloxan-3-yl) 3-methylpentanoate has a molecular weight of 214.30 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxan-3-yl) 3-methylpentanoate is sourced from PubChem (CID 163541839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).