About (4-methyloxan-4-yl) 3-methylbutanoate
(4-methyloxan-4-yl) 3-methylbutanoate (PubChem CID 68788887) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (4-methyloxan-4-yl) 3-methylbutanoate.
Molecular Properties
| Compound Name | (4-methyloxan-4-yl) 3-methylbutanoate |
| PubChem CID | 68788887 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4-methyloxan-4-yl) 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC1(C)CCOCC1 |
| InChI | InChI=1S/C11H20O3/c1-9(2)8-10(12)14-11(3)4-6-13-7-5-11/h9H,4-8H2,1-3H3 |
| InChIKey | YZLCIQYWRZMANK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyloxan-4-yl) 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyloxan-4-yl) 3-methylbutanoate?
The IUPAC name of (4-methyloxan-4-yl) 3-methylbutanoate (CID 68788887) is (4-methyloxan-4-yl) 3-methylbutanoate.
What is the SMILES notation for (4-methyloxan-4-yl) 3-methylbutanoate?
The canonical SMILES for (4-methyloxan-4-yl) 3-methylbutanoate is CC(C)CC(=O)OC1(C)CCOCC1.
What is the InChIKey of (4-methyloxan-4-yl) 3-methylbutanoate?
The InChIKey is YZLCIQYWRZMANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-9(2)8-10(12)14-11(3)4-6-13-7-5-11/h9H,4-8H2,1-3H3.
What are the key properties of (4-methyloxan-4-yl) 3-methylbutanoate?
(4-methyloxan-4-yl) 3-methylbutanoate has a molecular weight of 200.28 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyloxan-4-yl) 3-methylbutanoate is sourced from PubChem (CID 68788887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).