C16H21N11O — CID 163543122
3-N-methyl-3-N-[4-[[methyl-[5-[methyl(1H-pyrrol-2-yl)amino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-2-yl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 163543122) has the molecular formula C16H21N11O and a molecular weight of 383.42 g/mol. Its IUPAC name is 3-N-methyl-3-N-[4-[[methyl-[5-[methyl(1H-pyrrol-2-yl)amino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-2-yl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-methyl-3-N-[4-[[methyl-[5-[methyl(1H-pyrrol-2-yl)amino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-2-yl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 163543122 |
| Molecular Formula | C16H21N11O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-N-methyl-3-N-[4-[[methyl-[5-[methyl(1H-pyrrol-2-yl)amino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-2-yl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CN(Cc1coc(N(C)c2n[nH]c(N)n2)c1)c1n[nH]c(N(C)c2ccc[nH]2)n1 |
| InChI | InChI=1S/C16H21N11O/c1-25(14-20-16(24-22-14)26(2)11-5-4-6-18-11)8-10-7-12(28-9-10)27(3)15-19-13(17)21-23-15/h4-7,9,18H,8H2,1-3H3,(H,20,22,24)(H3,17,19,21,23) |
| InChIKey | FCUGVBPXMRMMJO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 147.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |