C14H31NO2 — CID 163543191
1-[[(3R)-6-methoxy-3,6-dimethylheptyl]amino]butan-2-ol (PubChem CID 163543191) has the molecular formula C14H31NO2 and a molecular weight of 245.41 g/mol. Its IUPAC name is 1-[[(3R)-6-methoxy-3,6-dimethylheptyl]amino]butan-2-ol.
| Compound Name | 1-[[(3R)-6-methoxy-3,6-dimethylheptyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 163543191 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 1-[[(3R)-6-methoxy-3,6-dimethylheptyl]amino]butan-2-ol |
| SMILES | CCC(O)CNCC[C@H](C)CCC(C)(C)OC |
| InChI | InChI=1S/C14H31NO2/c1-6-13(16)11-15-10-8-12(2)7-9-14(3,4)17-5/h12-13,15-16H,6-11H2,1-5H3/t12-,13?/m1/s1 |
| InChIKey | FCVQHXGAZBCEAO-PZORYLMUSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|