About 4,7-dioxododecyl methyl sulfate
4,7-dioxododecyl methyl sulfate (PubChem CID 163545261) has the molecular formula C13H24O6S
and a molecular weight of 308.40 g/mol. Its IUPAC name is 4,7-dioxododecyl methyl sulfate.
Molecular Properties
| Compound Name | 4,7-dioxododecyl methyl sulfate |
| PubChem CID | 163545261 |
| Molecular Formula | C13H24O6S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4,7-dioxododecyl methyl sulfate |
| SMILES | CCCCCC(=O)CCC(=O)CCCOS(=O)(=O)OC |
| InChI | InChI=1S/C13H24O6S/c1-3-4-5-7-12(14)9-10-13(15)8-6-11-19-20(16,17)18-2/h3-11H2,1-2H3 |
| InChIKey | BTGTVINZKBVWJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dioxododecyl methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dioxododecyl methyl sulfate?
The IUPAC name of 4,7-dioxododecyl methyl sulfate (CID 163545261) is 4,7-dioxododecyl methyl sulfate.
What is the SMILES notation for 4,7-dioxododecyl methyl sulfate?
The canonical SMILES for 4,7-dioxododecyl methyl sulfate is CCCCCC(=O)CCC(=O)CCCOS(=O)(=O)OC.
What is the InChIKey of 4,7-dioxododecyl methyl sulfate?
The InChIKey is BTGTVINZKBVWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O6S/c1-3-4-5-7-12(14)9-10-13(15)8-6-11-19-20(16,17)18-2/h3-11H2,1-2H3.
What are the key properties of 4,7-dioxododecyl methyl sulfate?
4,7-dioxododecyl methyl sulfate has a molecular weight of 308.40 g/mol, XLogP of 2.17, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dioxododecyl methyl sulfate is sourced from PubChem (CID 163545261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).