About hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium
hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium (PubChem CID 87410901) has the molecular formula C22H47NO6S
and a molecular weight of 453.69 g/mol. Its IUPAC name is hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium |
| PubChem CID | 87410901 |
| Molecular Formula | C22H47NO6S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].COS(=O)(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C16H32O2.C6H16NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-7(2,3)5-6-11-12(8,9)10-4/h2-15H2,1H3,(H,17,18);5-6H2,1-4H3/q;+1/p-1 |
| InChIKey | BXHNAIJFZQJZOC-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium?
The IUPAC name of hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium (CID 87410901) is hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium.
What is the SMILES notation for hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium?
The canonical SMILES for hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium is CCCCCCCCCCCCCCCC(=O)[O-].COS(=O)(=O)OCC[N+](C)(C)C.
What is the InChIKey of hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium?
The InChIKey is BXHNAIJFZQJZOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O2.C6H16NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-7(2,3)5-6-11-12(8,9)10-4/h2-15H2,1H3,(H,17,18);5-6H2,1-4H3/q;+1/p-1.
What are the key properties of hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium?
hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium has a molecular weight of 453.69 g/mol, XLogP of 3.82, 19 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoate;2-methoxysulfonyloxyethyl(trimethyl)azanium is sourced from PubChem (CID 87410901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).