C25H53NO7S — CID 87410905
2-hydroxyethyl-(2-methoxysulfonyloxyethyl)-dimethylazanium;octadecanoate (PubChem CID 87410905) has the molecular formula C25H53NO7S and a molecular weight of 511.77 g/mol. Its IUPAC name is 2-hydroxyethyl-(2-methoxysulfonyloxyethyl)-dimethylazanium;octadecanoate.
| Compound Name | 2-hydroxyethyl-(2-methoxysulfonyloxyethyl)-dimethylazanium;octadecanoate |
|---|---|
| PubChem CID | 87410905 |
| Molecular Formula | C25H53NO7S |
| Molecular Weight | 511.77 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | 2-hydroxyethyl-(2-methoxysulfonyloxyethyl)-dimethylazanium;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].COS(=O)(=O)OCC[N+](C)(C)CCO |
| InChI | InChI=1S/C18H36O2.C7H18NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-8(2,4-6-9)5-7-13-14(10,11)12-3/h2-17H2,1H3,(H,19,20);9H,4-7H2,1-3H3/q;+1/p-1 |
| InChIKey | LQDIYIHKWHUWTR-UHFFFAOYSA-M |
| XLogP | 3.96 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.77 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|