C8H20NO6S+ — CID 87410375
bis(2-hydroxyethyl)-(2-methoxysulfonyloxyethyl)-methylazanium (PubChem CID 87410375) has the molecular formula C8H20NO6S+ and a molecular weight of 258.32 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-(2-methoxysulfonyloxyethyl)-methylazanium.
| Compound Name | bis(2-hydroxyethyl)-(2-methoxysulfonyloxyethyl)-methylazanium |
|---|---|
| PubChem CID | 87410375 |
| Molecular Formula | C8H20NO6S+ |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | bis(2-hydroxyethyl)-(2-methoxysulfonyloxyethyl)-methylazanium |
| SMILES | COS(=O)(=O)OCC[N+](C)(CCO)CCO |
| InChI | InChI=1S/C8H20NO6S/c1-9(3-6-10,4-7-11)5-8-15-16(12,13)14-2/h10-11H,3-8H2,1-2H3/q+1 |
| InChIKey | VZWSZUKCDVIGOI-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|