C20H21N3 — CID 163545933
5-[2-methyl-4-(4-methylphenyl)phenyl]benzene-1,2,3-triamine (PubChem CID 163545933) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-[2-methyl-4-(4-methylphenyl)phenyl]benzene-1,2,3-triamine.
| Compound Name | 5-[2-methyl-4-(4-methylphenyl)phenyl]benzene-1,2,3-triamine |
|---|---|
| PubChem CID | 163545933 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-[2-methyl-4-(4-methylphenyl)phenyl]benzene-1,2,3-triamine |
| SMILES | Cc1ccc(-c2ccc(-c3cc(N)c(N)c(N)c3)c(C)c2)cc1 |
| InChI | InChI=1S/C20H21N3/c1-12-3-5-14(6-4-12)15-7-8-17(13(2)9-15)16-10-18(21)20(23)19(22)11-16/h3-11H,21-23H2,1-2H3 |
| InChIKey | FFAGKUSJXLNDTR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|