C42H23N5S — CID 163547620
4-[3-isocyano-4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]-2,6-diphenylpyrimidine-5-carbonitrile (PubChem CID 163547620) has the molecular formula C42H23N5S and a molecular weight of 629.75 g/mol. Its IUPAC name is 4-[3-isocyano-4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]-2,6-diphenylpyrimidine-5-carbonitrile.
| Compound Name | 4-[3-isocyano-4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]-2,6-diphenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 163547620 |
| Molecular Formula | C42H23N5S |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | 4-[3-isocyano-4-(9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]-2,6-diphenylpyrimidine-5-carbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)c2C#N)ccc1-n1c2ccccc2c2c3c(ccc21)sc1ccccc13 |
| InChI | InChI=1S/C42H23N5S/c1-44-32-24-28(41-31(25-43)40(26-12-4-2-5-13-26)45-42(46-41)27-14-6-3-7-15-27)20-21-34(32)47-33-18-10-8-16-29(33)38-35(47)22-23-37-39(38)30-17-9-11-19-36(30)48-37/h2-24H |
| InChIKey | UPILMZSIDGWNLF-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|