C42H23N5O — CID 163722504
4-[4-([1]benzofuro[2,3-b]carbazol-7-yl)-3-isocyanophenyl]-2,6-diphenylpyrimidine-5-carbonitrile (PubChem CID 163722504) has the molecular formula C42H23N5O and a molecular weight of 613.68 g/mol. Its IUPAC name is 4-[4-([1]benzofuro[2,3-b]carbazol-7-yl)-3-isocyanophenyl]-2,6-diphenylpyrimidine-5-carbonitrile.
| Compound Name | 4-[4-([1]benzofuro[2,3-b]carbazol-7-yl)-3-isocyanophenyl]-2,6-diphenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 163722504 |
| Molecular Formula | C42H23N5O |
| Molecular Weight | 613.68 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 4-[4-([1]benzofuro[2,3-b]carbazol-7-yl)-3-isocyanophenyl]-2,6-diphenylpyrimidine-5-carbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)c2C#N)ccc1-n1c2ccccc2c2cc3c(cc21)oc1ccccc13 |
| InChI | InChI=1S/C42H23N5O/c1-44-34-22-28(41-33(25-43)40(26-12-4-2-5-13-26)45-42(46-41)27-14-6-3-7-15-27)20-21-36(34)47-35-18-10-8-16-29(35)31-23-32-30-17-9-11-19-38(30)48-39(32)24-37(31)47/h2-24H |
| InChIKey | VZKNCXCWYDKITF-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 72.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.68 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|