C18H29N3O9S2 — CID 163550021
2-[[4-carboxy-2-[[4-[2-(ethyldisulfanyl)ethylamino]-4-oxobutanoyl]amino]butanoyl]amino]pentanedioic acid (PubChem CID 163550021) has the molecular formula C18H29N3O9S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[[4-carboxy-2-[[4-[2-(ethyldisulfanyl)ethylamino]-4-oxobutanoyl]amino]butanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-carboxy-2-[[4-[2-(ethyldisulfanyl)ethylamino]-4-oxobutanoyl]amino]butanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 163550021 |
| Molecular Formula | C18H29N3O9S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[[4-carboxy-2-[[4-[2-(ethyldisulfanyl)ethylamino]-4-oxobutanoyl]amino]butanoyl]amino]pentanedioic acid |
| SMILES | CCSSCCNC(=O)CCC(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H29N3O9S2/c1-2-31-32-10-9-19-13(22)5-6-14(23)20-11(3-7-15(24)25)17(28)21-12(18(29)30)4-8-16(26)27/h11-12H,2-10H2,1H3,(H,19,22)(H,20,23)(H,21,28)(H,24,25)(H,26,27)(H,29,30) |
| InChIKey | FIHINGDHZLRWLA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|