C16H27N3O8 — CID 118586391
(2S)-2-[[(2S)-4-carboxy-2-[[2-(diethylamino)acetyl]amino]butanoyl]amino]pentanedioic acid (PubChem CID 118586391) has the molecular formula C16H27N3O8 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-carboxy-2-[[2-(diethylamino)acetyl]amino]butanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-4-carboxy-2-[[2-(diethylamino)acetyl]amino]butanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 118586391 |
| Molecular Formula | C16H27N3O8 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2S)-2-[[(2S)-4-carboxy-2-[[2-(diethylamino)acetyl]amino]butanoyl]amino]pentanedioic acid |
| SMILES | CCN(CC)CC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N3O8/c1-3-19(4-2)9-12(20)17-10(5-7-13(21)22)15(25)18-11(16(26)27)6-8-14(23)24/h10-11H,3-9H2,1-2H3,(H,17,20)(H,18,25)(H,21,22)(H,23,24)(H,26,27)/t10-,11-/m0/s1 |
| InChIKey | CTPUCUZWPMYZGR-QWRGUYRKSA-N |
| XLogP | -0.89 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |