C19H15ClF6N4O3 — CID 163550473
5-(4-chlorophenyl)-2-methyl-6-(2,2,2-trifluoroethoxy)-N-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dihydropyridine-3-carboxamide (PubChem CID 163550473) has the molecular formula C19H15ClF6N4O3 and a molecular weight of 496.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-methyl-6-(2,2,2-trifluoroethoxy)-N-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dihydropyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-2-methyl-6-(2,2,2-trifluoroethoxy)-N-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 163550473 |
| Molecular Formula | C19H15ClF6N4O3 |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2-methyl-6-(2,2,2-trifluoroethoxy)-N-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dihydropyridine-3-carboxamide |
| SMILES | CC1NC(OCC(F)(F)F)=C(c2ccc(Cl)cc2)C=C1C(=O)NCc1nc(C(F)(F)F)no1 |
| InChI | InChI=1S/C19H15ClF6N4O3/c1-9-12(15(31)27-7-14-29-17(30-33-14)19(24,25)26)6-13(10-2-4-11(20)5-3-10)16(28-9)32-8-18(21,22)23/h2-6,9,28H,7-8H2,1H3,(H,27,31) |
| InChIKey | FIQIGWMTRZQZGN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |