C13H8Cl2F6N4O3 — CID 130274728
1-[2,6-dichloro-4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]-3-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]urea (PubChem CID 130274728) has the molecular formula C13H8Cl2F6N4O3 and a molecular weight of 453.13 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]-3-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]urea.
| Compound Name | 1-[2,6-dichloro-4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]-3-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 130274728 |
| Molecular Formula | C13H8Cl2F6N4O3 |
| Molecular Weight | 453.13 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 1-[2,6-dichloro-4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]-3-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]urea |
| SMILES | O=C(NCc1nc(C(F)(F)F)no1)Nc1c(Cl)cc([C@@H](O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H8Cl2F6N4O3/c14-5-1-4(9(26)12(16,17)18)2-6(15)8(5)24-11(27)22-3-7-23-10(25-28-7)13(19,20)21/h1-2,9,26H,3H2,(H2,22,24,27)/t9-/m1/s1 |
| InChIKey | WOODAWPUPDATRC-SECBINFHSA-N |
| XLogP | 4.31 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.13 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |