C14H9Cl2F7N4O3 — CID 130276609
1-[2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]urea (PubChem CID 130276609) has the molecular formula C14H9Cl2F7N4O3 and a molecular weight of 485.14 g/mol. Its IUPAC name is 1-[2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]urea.
| Compound Name | 1-[2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 130276609 |
| Molecular Formula | C14H9Cl2F7N4O3 |
| Molecular Weight | 485.14 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | 1-[2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]urea |
| SMILES | CC(O)(c1cc(Cl)c(NC(=O)NCc2noc(C(F)(F)F)n2)c(Cl)c1F)C(F)(F)F |
| InChI | InChI=1S/C14H9Cl2F7N4O3/c1-12(29,14(21,22)23)4-2-5(15)9(7(16)8(4)17)26-11(28)24-3-6-25-10(30-27-6)13(18,19)20/h2,29H,3H2,1H3,(H2,24,26,28) |
| InChIKey | IJLRUCDWKRIRKU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|