C17H19F4N3O2 — CID 71559173
N-(4-fluorophenyl)-2,2-dimethyl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide (PubChem CID 71559173) has the molecular formula C17H19F4N3O2 and a molecular weight of 373.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,2-dimethyl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide.
| Compound Name | N-(4-fluorophenyl)-2,2-dimethyl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide |
|---|---|
| PubChem CID | 71559173 |
| Molecular Formula | C17H19F4N3O2 |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(4-fluorophenyl)-2,2-dimethyl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide |
| SMILES | CC(C)(CCCCc1noc(C(F)(F)F)n1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H19F4N3O2/c1-16(2,14(25)22-12-8-6-11(18)7-9-12)10-4-3-5-13-23-15(26-24-13)17(19,20)21/h6-9H,3-5,10H2,1-2H3,(H,22,25) |
| InChIKey | SEKWIKVDQOYEOC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|