C18H21F3N4O3S2 — CID 167309149
S-sulfanyl N-methyl-N-[4-[7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]heptanoylamino]phenyl]carbamothioate (PubChem CID 167309149) has the molecular formula C18H21F3N4O3S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is S-sulfanyl N-methyl-N-[4-[7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]heptanoylamino]phenyl]carbamothioate.
| Compound Name | S-sulfanyl N-methyl-N-[4-[7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]heptanoylamino]phenyl]carbamothioate |
|---|---|
| PubChem CID | 167309149 |
| Molecular Formula | C18H21F3N4O3S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | S-sulfanyl N-methyl-N-[4-[7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]heptanoylamino]phenyl]carbamothioate |
| SMILES | CN(C(=O)SS)c1ccc(NC(=O)CCCCCCc2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H21F3N4O3S2/c1-25(17(27)30-29)13-10-8-12(9-11-13)22-15(26)7-5-3-2-4-6-14-23-16(28-24-14)18(19,20)21/h8-11,29H,2-7H2,1H3,(H,22,26) |
| InChIKey | FUZNKLGEFATQDO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|