C9H11F3N2O3 — CID 166977468
methyl 5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanoate (PubChem CID 166977468) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is methyl 5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanoate.
| Compound Name | methyl 5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanoate |
|---|---|
| PubChem CID | 166977468 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | methyl 5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanoate |
| SMILES | COC(=O)CCCCc1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2O3/c1-16-7(15)5-3-2-4-6-13-8(17-14-6)9(10,11)12/h2-5H2,1H3 |
| InChIKey | SZTGVNZWURNNRB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|