About 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole
2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole (PubChem CID 163551871) has the molecular formula C16H19N3
and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole |
| PubChem CID | 163551871 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole |
| SMILES | Cc1cccc(C2=NCc3nc(C(C)(C)C)cn32)c1 |
| InChI | InChI=1S/C16H19N3/c1-11-6-5-7-12(8-11)15-17-9-14-18-13(10-19(14)15)16(2,3)4/h5-8,10H,9H2,1-4H3 |
| InChIKey | HEEKOIVBWSQMJU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole?
The IUPAC name of 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole (CID 163551871) is 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole.
What is the SMILES notation for 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole?
The canonical SMILES for 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole is Cc1cccc(C2=NCc3nc(C(C)(C)C)cn32)c1.
What is the InChIKey of 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole?
The InChIKey is HEEKOIVBWSQMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3/c1-11-6-5-7-12(8-11)15-17-9-14-18-13(10-19(14)15)16(2,3)4/h5-8,10H,9H2,1-4H3.
What are the key properties of 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole?
2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole has a molecular weight of 253.35 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(3-methylphenyl)-7H-imidazo[1,2-c]imidazole is sourced from PubChem (CID 163551871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).