C21H24FNO4 — CID 163552817
(E)-3-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 163552817) has the molecular formula C21H24FNO4 and a molecular weight of 373.42 g/mol. Its IUPAC name is (E)-3-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 163552817 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (E)-3-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | COC1=CC=C(/C(=C\C(=O)N2CCOCC2)c2ccc(F)cc2)CC1OC |
| InChI | InChI=1S/C21H24FNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,14,20H,9-13H2,1-2H3/b18-14- |
| InChIKey | FKMFEANUCSLKQL-JXAWBTAJSA-N |
| XLogP | 2.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|