About [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate
[3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate (PubChem CID 163553102) has the molecular formula C17H23NO4S
and a molecular weight of 337.44 g/mol. Its IUPAC name is [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate.
Molecular Properties
| Compound Name | [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate |
| PubChem CID | 163553102 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate |
| SMILES | CCC1CN(OC(=O)c2ccccc2)CC1C(=O)C=S(C)(C)=O |
| InChI | InChI=1S/C17H23NO4S/c1-4-13-10-18(11-15(13)16(19)12-23(2,3)21)22-17(20)14-8-6-5-7-9-14/h5-9,12-13,15H,4,10-11H2,1-3H3 |
| InChIKey | FKSMHNBCLQZAQJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate?
The IUPAC name of [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate (CID 163553102) is [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate.
What is the SMILES notation for [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate?
The canonical SMILES for [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate is CCC1CN(OC(=O)c2ccccc2)CC1C(=O)C=S(C)(C)=O.
What is the InChIKey of [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate?
The InChIKey is FKSMHNBCLQZAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4S/c1-4-13-10-18(11-15(13)16(19)12-23(2,3)21)22-17(20)14-8-6-5-7-9-14/h5-9,12-13,15H,4,10-11H2,1-3H3.
What are the key properties of [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate?
[3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate has a molecular weight of 337.44 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidin-1-yl] benzoate is sourced from PubChem (CID 163553102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).