C14H11F5O4 — CID 163553110
5-(3-oxobut-1-en-2-yl)-2-(2,2,3,3,3-pentafluoropropoxy)benzoic acid (PubChem CID 163553110) has the molecular formula C14H11F5O4 and a molecular weight of 338.23 g/mol. Its IUPAC name is 5-(3-oxobut-1-en-2-yl)-2-(2,2,3,3,3-pentafluoropropoxy)benzoic acid.
| Compound Name | 5-(3-oxobut-1-en-2-yl)-2-(2,2,3,3,3-pentafluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 163553110 |
| Molecular Formula | C14H11F5O4 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5-(3-oxobut-1-en-2-yl)-2-(2,2,3,3,3-pentafluoropropoxy)benzoic acid |
| SMILES | C=C(C(C)=O)c1ccc(OCC(F)(F)C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H11F5O4/c1-7(8(2)20)9-3-4-11(10(5-9)12(21)22)23-6-13(15,16)14(17,18)19/h3-5H,1,6H2,2H3,(H,21,22) |
| InChIKey | FKSOPPNIKVCAIP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|