C27H25Br2ClIN2O2+ — CID 163555085
[5-[2-[4-(6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl)piperidin-1-yl]-2-oxoethyl]-1λ3-iodacyclohepta-3,5,7-trien-2-yl]oxidanium (PubChem CID 163555085) has the molecular formula C27H25Br2ClIN2O2+ and a molecular weight of 731.67 g/mol. Its IUPAC name is [5-[2-[4-(6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl)piperidin-1-yl]-2-oxoethyl]-1λ3-iodacyclohepta-3,5,7-trien-2-yl]oxidanium.
| Compound Name | [5-[2-[4-(6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl)piperidin-1-yl]-2-oxoethyl]-1λ3-iodacyclohepta-3,5,7-trien-2-yl]oxidanium |
|---|---|
| PubChem CID | 163555085 |
| Molecular Formula | C27H25Br2ClIN2O2+ |
| Molecular Weight | 731.67 g/mol |
| Exact Mass | 728.90 |
| IUPAC Name | [5-[2-[4-(6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl)piperidin-1-yl]-2-oxoethyl]-1λ3-iodacyclohepta-3,5,7-trien-2-yl]oxidanium |
| SMILES | O=C(CC1=CC=IC([OH2+])C=C1)N1CCC(C2c3ncc(Br)cc3C=Cc3cc(Cl)cc(Br)c32)CC1 |
| InChI | InChI=1S/C27H24Br2ClIN2O2/c28-20-12-19-3-2-18-13-21(30)14-22(29)25(18)26(27(19)32-15-20)17-6-9-33(10-7-17)24(35)11-16-1-4-23(34)31-8-5-16/h1-5,8,12-15,17,23,26,34H,6-7,9-11H2/p+1 |
| InChIKey | FMIIYKOJAFVTFE-UHFFFAOYSA-O |
| XLogP | 6.82 |
| TPSA | 56.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|