C32H37Br2ClN3NaO4 — CID 23670459
sodium 6-[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]piperidin-1-yl]-6-oxohexanoate (PubChem CID 23670459) has the molecular formula C32H37Br2ClN3NaO4 and a molecular weight of 745.92 g/mol. Its IUPAC name is sodium 6-[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]piperidin-1-yl]-6-oxohexanoate.
| Compound Name | sodium 6-[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]piperidin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 23670459 |
| Molecular Formula | C32H37Br2ClN3NaO4 |
| Molecular Weight | 745.92 g/mol |
| Exact Mass | 743.07 |
| IUPAC Name | sodium 6-[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]piperidin-1-yl]-6-oxohexanoate |
| SMILES | O=C([O-])CCCCC(=O)N1CCC(CC(=O)N2CCC([C@H]3c4ncc(Br)cc4CCc4cc(Cl)cc(Br)c43)CC2)CC1.[Na+] |
| InChI | InChI=1S/C32H38Br2ClN3O4.Na/c33-24-16-23-6-5-22-17-25(35)18-26(34)30(22)31(32(23)36-19-24)21-9-13-38(14-10-21)28(40)15-20-7-11-37(12-8-20)27(39)3-1-2-4-29(41)42;/h16-21,31H,1-15H2,(H,41,42);/q;+1/p-1/t31-;/m1./s1 |
| InChIKey | RIUJUWLTCKEBOD-JSSVAETHSA-M |
| XLogP | 2.67 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.92 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|