C30H34Br2ClN3O3 — CID 59896892
1-[[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexylidene]amino]oxypropan-2-one (PubChem CID 59896892) has the molecular formula C30H34Br2ClN3O3 and a molecular weight of 679.88 g/mol. Its IUPAC name is 1-[[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexylidene]amino]oxypropan-2-one.
| Compound Name | 1-[[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexylidene]amino]oxypropan-2-one |
|---|---|
| PubChem CID | 59896892 |
| Molecular Formula | C30H34Br2ClN3O3 |
| Molecular Weight | 679.88 g/mol |
| Exact Mass | 677.07 |
| IUPAC Name | 1-[[4-[2-[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexylidene]amino]oxypropan-2-one |
| SMILES | CC(=O)CON=C1CCC(CC(=O)N2CCC([C@H]3c4ncc(Br)cc4CCc4cc(Cl)cc(Br)c43)CC2)CC1 |
| InChI | InChI=1S/C30H34Br2ClN3O3/c1-18(37)17-39-35-25-6-2-19(3-7-25)12-27(38)36-10-8-20(9-11-36)29-28-21(14-24(33)15-26(28)32)4-5-22-13-23(31)16-34-30(22)29/h13-16,19-20,29H,2-12,17H2,1H3/b35-25-/t19?,29-/m1/s1 |
| InChIKey | NXWQMMDCFCMZQG-WDSOVBFOSA-N |
| XLogP | 7.27 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.88 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|