C19H21NO7 — CID 163556292
2-[7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]ethyl 2-methylprop-2-enoate (PubChem CID 163556292) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163556292 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN1C(=O)C2C3C=CC(COC(=O)C(=C)C)(O3)C2C1=O |
| InChI | InChI=1S/C19H21NO7/c1-10(2)17(23)25-8-7-20-15(21)13-12-5-6-19(27-12,14(13)16(20)22)9-26-18(24)11(3)4/h5-6,12-14H,1,3,7-9H2,2,4H3 |
| InChIKey | FNIMVTBCMOYZPY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|